About 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea
1-(pentafluoro-λ6-sulfanyl)-1-phenylurea (PubChem CID 135203261) has the molecular formula C7H7F5N2OS
and a molecular weight of 262.20 g/mol. Its IUPAC name is 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea.
Molecular Properties
| Compound Name | 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea |
| PubChem CID | 135203261 |
| Molecular Formula | C7H7F5N2OS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea |
| SMILES | NC(=O)N(c1ccccc1)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C7H7F5N2OS/c8-16(9,10,11,12)14(7(13)15)6-4-2-1-3-5-6/h1-5H,(H2,13,15) |
| InChIKey | VEHOFTBYPOXFHS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea?
The IUPAC name of 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea (CID 135203261) is 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea.
What is the SMILES notation for 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea?
The canonical SMILES for 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea is NC(=O)N(c1ccccc1)S(F)(F)(F)(F)F.
What is the InChIKey of 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea?
The InChIKey is VEHOFTBYPOXFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F5N2OS/c8-16(9,10,11,12)14(7(13)15)6-4-2-1-3-5-6/h1-5H,(H2,13,15).
What are the key properties of 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea?
1-(pentafluoro-λ6-sulfanyl)-1-phenylurea has a molecular weight of 262.20 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pentafluoro-λ6-sulfanyl)-1-phenylurea is sourced from PubChem (CID 135203261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).