C13H13ClN4O — CID 135209005
N,N'-diamino-3-(4-chlorophenoxy)benzenecarboximidamide (PubChem CID 135209005) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is N,N'-diamino-3-(4-chlorophenoxy)benzenecarboximidamide.
| Compound Name | N,N'-diamino-3-(4-chlorophenoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 135209005 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N,N'-diamino-3-(4-chlorophenoxy)benzenecarboximidamide |
| SMILES | N/N=C(\NN)c1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C13H13ClN4O/c14-10-4-6-11(7-5-10)19-12-3-1-2-9(8-12)13(17-15)18-16/h1-8H,15-16H2,(H,17,18) |
| InChIKey | CUHIIAWGJISGOS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|