C19H23NO5 — CID 135210466
4-[hydroxy(methoxy)methyl]-1-[(4-methoxyphenyl)methyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-one (PubChem CID 135210466) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[hydroxy(methoxy)methyl]-1-[(4-methoxyphenyl)methyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-one.
| Compound Name | 4-[hydroxy(methoxy)methyl]-1-[(4-methoxyphenyl)methyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 135210466 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-[hydroxy(methoxy)methyl]-1-[(4-methoxyphenyl)methyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-one |
| SMILES | COc1ccc(Cn2c3c(c(C(O)OC)cc2=O)CCOCC3)cc1 |
| InChI | InChI=1S/C19H23NO5/c1-23-14-5-3-13(4-6-14)12-20-17-8-10-25-9-7-15(17)16(11-18(20)21)19(22)24-2/h3-6,11,19,22H,7-10,12H2,1-2H3 |
| InChIKey | DYOMLCOQFGHTQI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|