C15H15NO6 — CID 135210628
6-[hydroxy(methoxy)methyl]-2-oxo-1-phenylmethoxypyridine-3-carboxylic acid (PubChem CID 135210628) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 6-[hydroxy(methoxy)methyl]-2-oxo-1-phenylmethoxypyridine-3-carboxylic acid.
| Compound Name | 6-[hydroxy(methoxy)methyl]-2-oxo-1-phenylmethoxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 135210628 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 6-[hydroxy(methoxy)methyl]-2-oxo-1-phenylmethoxypyridine-3-carboxylic acid |
| SMILES | COC(O)c1ccc(C(=O)O)c(=O)n1OCc1ccccc1 |
| InChI | InChI=1S/C15H15NO6/c1-21-15(20)12-8-7-11(14(18)19)13(17)16(12)22-9-10-5-3-2-4-6-10/h2-8,15,20H,9H2,1H3,(H,18,19) |
| InChIKey | VJLYUEOQGJLGHE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|