C13H33N3O3 — CID 135210797
2-[(2-amino-2-methylpropyl)-methylamino]ethanol;2-[2-(dimethylamino)ethoxy]ethanol (PubChem CID 135210797) has the molecular formula C13H33N3O3 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-[(2-amino-2-methylpropyl)-methylamino]ethanol;2-[2-(dimethylamino)ethoxy]ethanol.
| Compound Name | 2-[(2-amino-2-methylpropyl)-methylamino]ethanol;2-[2-(dimethylamino)ethoxy]ethanol |
|---|---|
| PubChem CID | 135210797 |
| Molecular Formula | C13H33N3O3 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.25 |
| IUPAC Name | 2-[(2-amino-2-methylpropyl)-methylamino]ethanol;2-[2-(dimethylamino)ethoxy]ethanol |
| SMILES | CN(C)CCOCCO.CN(CCO)CC(C)(C)N |
| InChI | InChI=1S/C7H18N2O.C6H15NO2/c1-7(2,8)6-9(3)4-5-10;1-7(2)3-5-9-6-4-8/h10H,4-6,8H2,1-3H3;8H,3-6H2,1-2H3 |
| InChIKey | FUKOHPWOYYUWAX-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|