C28H47IO2 — CID 135212208
(3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6,6-dimethylheptan-2-yl]-3-iodo-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 135212208) has the molecular formula C28H47IO2 and a molecular weight of 542.59 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6,6-dimethylheptan-2-yl]-3-iodo-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6,6-dimethylheptan-2-yl]-3-iodo-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 135212208 |
| Molecular Formula | C28H47IO2 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6,6-dimethylheptan-2-yl]-3-iodo-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCC(O)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@](O)(I)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47IO2/c1-18(7-12-24(30)25(2,3)4)21-10-11-22-20-9-8-19-17-28(29,31)16-15-26(19,5)23(20)13-14-27(21,22)6/h17-18,20-24,30-31H,7-16H2,1-6H3/t18-,20+,21-,22+,23+,24?,26+,27-,28+/m1/s1 |
| InChIKey | QRMQMZHMTBXVOP-MPRZJVLYSA-N |
| XLogP | 7.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|