C20H25N3O2S — CID 135214142
1-[[(3S)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-1-prop-2-enyl-3-(2-thiophen-3-ylethyl)urea (PubChem CID 135214142) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-[[(3S)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-1-prop-2-enyl-3-(2-thiophen-3-ylethyl)urea.
| Compound Name | 1-[[(3S)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-1-prop-2-enyl-3-(2-thiophen-3-ylethyl)urea |
|---|---|
| PubChem CID | 135214142 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-[[(3S)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-1-prop-2-enyl-3-(2-thiophen-3-ylethyl)urea |
| SMILES | C=CCN(C[C@@H]1Cc2ccc(O)cc2CN1)C(=O)NCCc1ccsc1 |
| InChI | InChI=1S/C20H25N3O2S/c1-2-8-23(20(25)21-7-5-15-6-9-26-14-15)13-18-10-16-3-4-19(24)11-17(16)12-22-18/h2-4,6,9,11,14,18,22,24H,1,5,7-8,10,12-13H2,(H,21,25)/t18-/m0/s1 |
| InChIKey | KBIVUEWYNBDNHW-SFHVURJKSA-N |
| XLogP | 2.91 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|