C37H53N5O9 — CID 135214622
1-hexanoyl-N-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-1-[[2-[(2-methyl-1-oxopropan-2-yl)-propan-2-ylamino]-2-oxoethyl]amino]-1-oxohexan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 135214622) has the molecular formula C37H53N5O9 and a molecular weight of 711.86 g/mol. Its IUPAC name is 1-hexanoyl-N-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-1-[[2-[(2-methyl-1-oxopropan-2-yl)-propan-2-ylamino]-2-oxoethyl]amino]-1-oxohexan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-hexanoyl-N-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-1-[[2-[(2-methyl-1-oxopropan-2-yl)-propan-2-ylamino]-2-oxoethyl]amino]-1-oxohexan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135214622 |
| Molecular Formula | C37H53N5O9 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | 1-hexanoyl-N-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-1-[[2-[(2-methyl-1-oxopropan-2-yl)-propan-2-ylamino]-2-oxoethyl]amino]-1-oxohexan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCCCC(=O)N1CCCC1C(=O)NC(CCCCNC(=O)c1cc2ccc(OC)cc2oc1=O)C(=O)NCC(=O)N(C(C)C)C(C)(C)C=O |
| InChI | InChI=1S/C37H53N5O9/c1-7-8-9-15-31(44)41-19-12-14-29(41)35(48)40-28(34(47)39-22-32(45)42(24(2)3)37(4,5)23-43)13-10-11-18-38-33(46)27-20-25-16-17-26(50-6)21-30(25)51-36(27)49/h16-17,20-21,23-24,28-29H,7-15,18-19,22H2,1-6H3,(H,38,46)(H,39,47)(H,40,48) |
| InChIKey | XDFXZLNHPYBHNG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 184.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|