C30H54N4O4 — CID 135214785
(2S)-N-[1-[[2-[tert-butyl(propan-2-yl)amino]-2-oxoethyl]amino]-1-oxodecan-2-yl]-1-[(E)-hex-2-enoyl]pyrrolidine-2-carboxamide (PubChem CID 135214785) has the molecular formula C30H54N4O4 and a molecular weight of 534.79 g/mol. Its IUPAC name is (2S)-N-[1-[[2-[tert-butyl(propan-2-yl)amino]-2-oxoethyl]amino]-1-oxodecan-2-yl]-1-[(E)-hex-2-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-[[2-[tert-butyl(propan-2-yl)amino]-2-oxoethyl]amino]-1-oxodecan-2-yl]-1-[(E)-hex-2-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135214785 |
| Molecular Formula | C30H54N4O4 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | (2S)-N-[1-[[2-[tert-butyl(propan-2-yl)amino]-2-oxoethyl]amino]-1-oxodecan-2-yl]-1-[(E)-hex-2-enoyl]pyrrolidine-2-carboxamide |
| SMILES | CCC/C=C/C(=O)N1CCC[C@H]1C(=O)NC(CCCCCCCC)C(=O)NCC(=O)N(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H54N4O4/c1-8-10-12-13-14-16-18-24(28(37)31-22-27(36)34(23(3)4)30(5,6)7)32-29(38)25-19-17-21-33(25)26(35)20-15-11-9-2/h15,20,23-25H,8-14,16-19,21-22H2,1-7H3,(H,31,37)(H,32,38)/b20-15+/t24?,25-/m0/s1 |
| InChIKey | BAWBHQOBHFWGAN-CJDFZMKJSA-N |
| XLogP | 4.72 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|