C17H23N3OS — CID 135222311
5-[4-[(3-prop-2-enylphenyl)methoxy]butyl]-6H-1,3,4-thiadiazin-2-amine (PubChem CID 135222311) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 5-[4-[(3-prop-2-enylphenyl)methoxy]butyl]-6H-1,3,4-thiadiazin-2-amine.
| Compound Name | 5-[4-[(3-prop-2-enylphenyl)methoxy]butyl]-6H-1,3,4-thiadiazin-2-amine |
|---|---|
| PubChem CID | 135222311 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 5-[4-[(3-prop-2-enylphenyl)methoxy]butyl]-6H-1,3,4-thiadiazin-2-amine |
| SMILES | C=CCc1cccc(COCCCCC2=NN=C(N)SC2)c1 |
| InChI | InChI=1S/C17H23N3OS/c1-2-6-14-7-5-8-15(11-14)12-21-10-4-3-9-16-13-22-17(18)20-19-16/h2,5,7-8,11H,1,3-4,6,9-10,12-13H2,(H2,18,20) |
| InChIKey | SYVRDXSEEHZYPS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|