C25H25N5O4S — CID 135223126
1-[4-(benzenesulfonamido)phenyl]-3-[2-(4-methoxyphenyl)-1-(1H-pyrazol-4-yl)ethyl]urea (PubChem CID 135223126) has the molecular formula C25H25N5O4S and a molecular weight of 491.57 g/mol. Its IUPAC name is 1-[4-(benzenesulfonamido)phenyl]-3-[2-(4-methoxyphenyl)-1-(1H-pyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[4-(benzenesulfonamido)phenyl]-3-[2-(4-methoxyphenyl)-1-(1H-pyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 135223126 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 1-[4-(benzenesulfonamido)phenyl]-3-[2-(4-methoxyphenyl)-1-(1H-pyrazol-4-yl)ethyl]urea |
| SMILES | COc1ccc(CC(NC(=O)Nc2ccc(NS(=O)(=O)c3ccccc3)cc2)c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C25H25N5O4S/c1-34-22-13-7-18(8-14-22)15-24(19-16-26-27-17-19)29-25(31)28-20-9-11-21(12-10-20)30-35(32,33)23-5-3-2-4-6-23/h2-14,16-17,24,30H,15H2,1H3,(H,26,27)(H2,28,29,31) |
| InChIKey | AIMYUOKIXDPXQT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |