C18H18N4O3S — CID 171138998
1-(4-methoxyphenyl)-3-[2-phenyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)ethyl]urea (PubChem CID 171138998) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[2-phenyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)ethyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[2-phenyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 171138998 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[2-phenyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NC(Cc2ccccc2)c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-24-14-9-7-13(8-10-14)19-17(23)20-15(16-21-22-18(26)25-16)11-12-5-3-2-4-6-12/h2-10,15H,11H2,1H3,(H,22,26)(H2,19,20,23) |
| InChIKey | SURJRYMPGNQVBA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|