C33H36N4O6S — CID 142973965
2-[[4-(1,2-diphenylethylcarbamoylamino)phenyl]sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]-N-hydroxypropanamide (PubChem CID 142973965) has the molecular formula C33H36N4O6S and a molecular weight of 616.74 g/mol. Its IUPAC name is 2-[[4-(1,2-diphenylethylcarbamoylamino)phenyl]sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]-N-hydroxypropanamide.
| Compound Name | 2-[[4-(1,2-diphenylethylcarbamoylamino)phenyl]sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 142973965 |
| Molecular Formula | C33H36N4O6S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 2-[[4-(1,2-diphenylethylcarbamoylamino)phenyl]sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]-N-hydroxypropanamide |
| SMILES | COc1ccc(CCN(C(C)C(=O)NO)S(=O)(=O)c2ccc(NC(=O)NC(Cc3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H36N4O6S/c1-24(32(38)36-40)37(22-21-25-13-17-29(43-2)18-14-25)44(41,42)30-19-15-28(16-20-30)34-33(39)35-31(27-11-7-4-8-12-27)23-26-9-5-3-6-10-26/h3-20,24,31,40H,21-23H2,1-2H3,(H,36,38)(H2,34,35,39) |
| InChIKey | HDBNWKWIMZLKDH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|