C10H16N4O2 — CID 135226355
2-(2-aminoimidazol-1-yl)-3,3-diethoxypropanenitrile (PubChem CID 135226355) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(2-aminoimidazol-1-yl)-3,3-diethoxypropanenitrile.
| Compound Name | 2-(2-aminoimidazol-1-yl)-3,3-diethoxypropanenitrile |
|---|---|
| PubChem CID | 135226355 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(2-aminoimidazol-1-yl)-3,3-diethoxypropanenitrile |
| SMILES | CCOC(OCC)C(C#N)n1ccnc1N |
| InChI | InChI=1S/C10H16N4O2/c1-3-15-9(16-4-2)8(7-11)14-6-5-13-10(14)12/h5-6,8-9H,3-4H2,1-2H3,(H2,12,13) |
| InChIKey | QXIZXFMNXNVBBT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|