C23H16ClF2IN2O2S2 — CID 135227180
[4-[5-(1-chlorocyclopropyl)sulfanyl-2-(2,4-difluorophenoxy)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite (PubChem CID 135227180) has the molecular formula C23H16ClF2IN2O2S2 and a molecular weight of 616.88 g/mol. Its IUPAC name is [4-[5-(1-chlorocyclopropyl)sulfanyl-2-(2,4-difluorophenoxy)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite.
| Compound Name | [4-[5-(1-chlorocyclopropyl)sulfanyl-2-(2,4-difluorophenoxy)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 135227180 |
| Molecular Formula | C23H16ClF2IN2O2S2 |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 615.94 |
| IUPAC Name | [4-[5-(1-chlorocyclopropyl)sulfanyl-2-(2,4-difluorophenoxy)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
| SMILES | Cn1cc(-c2cc(SC3(Cl)CC3)ccc2Oc2ccc(F)cc2F)c2ccn(SI)c2c1=O |
| InChI | InChI=1S/C23H16ClF2IN2O2S2/c1-28-12-17(15-6-9-29(33-27)21(15)22(28)30)16-11-14(32-23(24)7-8-23)3-5-19(16)31-20-4-2-13(25)10-18(20)26/h2-6,9-12H,7-8H2,1H3 |
| InChIKey | DYHUVILQZDLLBA-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|