C21H23IN4OS — CID 146326872
[4-[5-amino-2-(6-azaspiro[2.5]octan-6-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite (PubChem CID 146326872) has the molecular formula C21H23IN4OS and a molecular weight of 506.41 g/mol. Its IUPAC name is [4-[5-amino-2-(6-azaspiro[2.5]octan-6-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite.
| Compound Name | [4-[5-amino-2-(6-azaspiro[2.5]octan-6-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 146326872 |
| Molecular Formula | C21H23IN4OS |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | [4-[5-amino-2-(6-azaspiro[2.5]octan-6-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
| SMILES | Cn1cc(-c2cc(N)ccc2N2CCC3(CC2)CC3)c2ccn(SI)c2c1=O |
| InChI | InChI=1S/C21H23IN4OS/c1-24-13-17(15-4-9-26(28-22)19(15)20(24)27)16-12-14(23)2-3-18(16)25-10-7-21(5-6-21)8-11-25/h2-4,9,12-13H,5-8,10-11,23H2,1H3 |
| InChIKey | HPJCGMBZSRRNDE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|