C16H22BIN2O3S — CID 171083418
[6-methyl-7-oxo-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite (PubChem CID 171083418) has the molecular formula C16H22BIN2O3S and a molecular weight of 460.15 g/mol. Its IUPAC name is [6-methyl-7-oxo-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite.
| Compound Name | [6-methyl-7-oxo-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 171083418 |
| Molecular Formula | C16H22BIN2O3S |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | [6-methyl-7-oxo-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
| SMILES | CC(C)C1(C)OB(c2cn(C)c(=O)c3c2ccn3SI)OC1(C)C |
| InChI | InChI=1S/C16H22BIN2O3S/c1-10(2)16(5)15(3,4)22-17(23-16)12-9-19(6)14(21)13-11(12)7-8-20(13)24-18/h7-10H,1-6H3 |
| InChIKey | LDQRNUFCMGJNMX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|