C22H19N — CID 135227525
N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-methylphenanthren-9-amine (PubChem CID 135227525) has the molecular formula C22H19N and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-methylphenanthren-9-amine.
| Compound Name | N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-methylphenanthren-9-amine |
|---|---|
| PubChem CID | 135227525 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-methylphenanthren-9-amine |
| SMILES | C#C/C=C\C(=C/C)N(C)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C22H19N/c1-4-6-12-18(5-2)23(3)22-16-17-11-7-8-13-19(17)20-14-9-10-15-21(20)22/h1,5-16H,2-3H3/b12-6-,18-5+ |
| InChIKey | RHVOECCYJCGOPV-RFHQQVIFSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|