C24H37N — CID 135228780
N-[(1E,4E,6Z)-4-(4-cyclohexylpent-4-en-2-yl)-2,5-dimethylnona-1,4,6,8-tetraenyl]ethanimine (PubChem CID 135228780) has the molecular formula C24H37N and a molecular weight of 339.57 g/mol. Its IUPAC name is N-[(1E,4E,6Z)-4-(4-cyclohexylpent-4-en-2-yl)-2,5-dimethylnona-1,4,6,8-tetraenyl]ethanimine.
| Compound Name | N-[(1E,4E,6Z)-4-(4-cyclohexylpent-4-en-2-yl)-2,5-dimethylnona-1,4,6,8-tetraenyl]ethanimine |
|---|---|
| PubChem CID | 135228780 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | N-[(1E,4E,6Z)-4-(4-cyclohexylpent-4-en-2-yl)-2,5-dimethylnona-1,4,6,8-tetraenyl]ethanimine |
| SMILES | C=C/C=C\C(C)=C(/C/C(C)=C/N=C/C)C(C)CC(=C)C1CCCCC1 |
| InChI | InChI=1S/C24H37N/c1-7-9-13-20(4)24(16-19(3)18-25-8-2)22(6)17-21(5)23-14-11-10-12-15-23/h7-9,13,18,22-23H,1,5,10-12,14-17H2,2-4,6H3/b13-9-,19-18+,24-20+,25-8+ |
| InChIKey | VFFMSWFSCZEYTA-RHVYTRBISA-N |
| XLogP | 7.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|