C22H22N4O3S — CID 135231270
methyl 3-[[[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfanylamino]methyl]benzoate (PubChem CID 135231270) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is methyl 3-[[[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfanylamino]methyl]benzoate.
| Compound Name | methyl 3-[[[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfanylamino]methyl]benzoate |
|---|---|
| PubChem CID | 135231270 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | methyl 3-[[[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfanylamino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CNSc2ccc(NC(=O)NCc3ccncc3)cc2)c1 |
| InChI | InChI=1S/C22H22N4O3S/c1-29-21(27)18-4-2-3-17(13-18)15-25-30-20-7-5-19(6-8-20)26-22(28)24-14-16-9-11-23-12-10-16/h2-13,25H,14-15H2,1H3,(H2,24,26,28) |
| InChIKey | WDAVLTZTNRHHDL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|