C21H19N5OS — CID 135231518
1-[4-[(2-cyanophenyl)methylamino]sulfanylphenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 135231518) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-[4-[(2-cyanophenyl)methylamino]sulfanylphenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[4-[(2-cyanophenyl)methylamino]sulfanylphenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135231518 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-[4-[(2-cyanophenyl)methylamino]sulfanylphenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | N#Cc1ccccc1CNSc1ccc(NC(=O)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C21H19N5OS/c22-13-17-3-1-2-4-18(17)15-25-28-20-7-5-19(6-8-20)26-21(27)24-14-16-9-11-23-12-10-16/h1-12,25H,14-15H2,(H2,24,26,27) |
| InChIKey | HSQQTJHBQGQFKU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|