C17H23N5OS — CID 135231291
1-[4-[cyclopentyl(methyl)amino]sulfanylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea (PubChem CID 135231291) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[4-[cyclopentyl(methyl)amino]sulfanylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea.
| Compound Name | 1-[4-[cyclopentyl(methyl)amino]sulfanylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135231291 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[4-[cyclopentyl(methyl)amino]sulfanylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
| SMILES | CN(Sc1ccc(NC(=O)NCc2cn[nH]c2)cc1)C1CCCC1 |
| InChI | InChI=1S/C17H23N5OS/c1-22(15-4-2-3-5-15)24-16-8-6-14(7-9-16)21-17(23)18-10-13-11-19-20-12-13/h6-9,11-12,15H,2-5,10H2,1H3,(H,19,20)(H2,18,21,23) |
| InChIKey | YPXYAXLFAJCKBO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|