C27H30N8O5S2 — CID 135234046
2-(5-hydroxy-2-pyridinyl)-N-[5-[(1S,3S)-3-[5-[[2-[5-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 135234046) has the molecular formula C27H30N8O5S2 and a molecular weight of 610.72 g/mol. Its IUPAC name is 2-(5-hydroxy-2-pyridinyl)-N-[5-[(1S,3S)-3-[5-[[2-[5-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(5-hydroxy-2-pyridinyl)-N-[5-[(1S,3S)-3-[5-[[2-[5-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 135234046 |
| Molecular Formula | C27H30N8O5S2 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 2-(5-hydroxy-2-pyridinyl)-N-[5-[(1S,3S)-3-[5-[[2-[5-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COCCOc1ccc(CC(=O)Nc2nnc([C@H]3CCC[C@H](c4nnc(NC(=O)Cc5ccc(O)cn5)s4)C3)s2)nc1 |
| InChI | InChI=1S/C27H30N8O5S2/c1-39-9-10-40-21-8-6-19(29-15-21)13-23(38)31-27-35-33-25(42-27)17-4-2-3-16(11-17)24-32-34-26(41-24)30-22(37)12-18-5-7-20(36)14-28-18/h5-8,14-17,36H,2-4,9-13H2,1H3,(H,30,34,37)(H,31,35,38)/t16-,17-/m0/s1 |
| InChIKey | DSTWVQGCCNSTKZ-IRXDYDNUSA-N |
| XLogP | 3.71 |
| TPSA | 174.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|