C18H24N4O3S — CID 135234064
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[4-(2-methoxyethoxy)-2-pyridinyl]acetamide (PubChem CID 135234064) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[4-(2-methoxyethoxy)-2-pyridinyl]acetamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[4-(2-methoxyethoxy)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 135234064 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[4-(2-methoxyethoxy)-2-pyridinyl]acetamide |
| SMILES | COCCOc1ccnc(CC(=O)Nc2nnc(C3CCCCC3)s2)c1 |
| InChI | InChI=1S/C18H24N4O3S/c1-24-9-10-25-15-7-8-19-14(11-15)12-16(23)20-18-22-21-17(26-18)13-5-3-2-4-6-13/h7-8,11,13H,2-6,9-10,12H2,1H3,(H,20,22,23) |
| InChIKey | DLBYXPUWWSDRIN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|