C21H26N7O4S2+ — CID 123424052
[5-[3-[5-[[2-[4-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-methyl-oxoazanium (PubChem CID 123424052) has the molecular formula C21H26N7O4S2+ and a molecular weight of 504.62 g/mol. Its IUPAC name is [5-[3-[5-[[2-[4-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-methyl-oxoazanium.
| Compound Name | [5-[3-[5-[[2-[4-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 123424052 |
| Molecular Formula | C21H26N7O4S2+ |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [5-[3-[5-[[2-[4-(2-methoxyethoxy)-2-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-methyl-oxoazanium |
| SMILES | COCCOc1ccnc(CC(=O)Nc2nnc(C3CCCC(c4nnc([N+](C)=O)s4)C3)s2)c1 |
| InChI | InChI=1S/C21H25N7O4S2/c1-28(30)21-27-25-19(34-21)14-5-3-4-13(10-14)18-24-26-20(33-18)23-17(29)12-15-11-16(6-7-22-15)32-9-8-31-2/h6-7,11,13-14H,3-5,8-10,12H2,1-2H3/p+1 |
| InChIKey | PBLPSJJZLROGQU-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 132.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|