C14H23N — CID 135235364
(2Z)-1-(2,3-dimethylbut-3-en-2-yl)-2-ethylidene-3-methyl-5-methylidenepyrrolidine (PubChem CID 135235364) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (2Z)-1-(2,3-dimethylbut-3-en-2-yl)-2-ethylidene-3-methyl-5-methylidenepyrrolidine.
| Compound Name | (2Z)-1-(2,3-dimethylbut-3-en-2-yl)-2-ethylidene-3-methyl-5-methylidenepyrrolidine |
|---|---|
| PubChem CID | 135235364 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (2Z)-1-(2,3-dimethylbut-3-en-2-yl)-2-ethylidene-3-methyl-5-methylidenepyrrolidine |
| SMILES | C=C1CC(C)/C(=C/C)N1C(C)(C)C(=C)C |
| InChI | InChI=1S/C14H23N/c1-8-13-11(4)9-12(5)15(13)14(6,7)10(2)3/h8,11H,2,5,9H2,1,3-4,6-7H3/b13-8- |
| InChIKey | ICNRGILQMQYCBH-JYRVWZFOSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|