About (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one
(2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one (PubChem CID 151973447) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one |
| PubChem CID | 151973447 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one |
| SMILES | C/C=C1\CC(C)C(C)CC1=O |
| InChI | InChI=1S/C10H16O/c1-4-9-5-7(2)8(3)6-10(9)11/h4,7-8H,5-6H2,1-3H3/b9-4+ |
| InChIKey | UBDVHUCXWZCAIJ-RUDMXATFSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one?
The IUPAC name of (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one (CID 151973447) is (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one.
What is the SMILES notation for (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one?
The canonical SMILES for (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one is C/C=C1\CC(C)C(C)CC1=O.
What is the InChIKey of (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one?
The InChIKey is UBDVHUCXWZCAIJ-RUDMXATFSA-N. The full InChI is InChI=1S/C10H16O/c1-4-9-5-7(2)8(3)6-10(9)11/h4,7-8H,5-6H2,1-3H3/b9-4+.
What are the key properties of (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one?
(2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one has a molecular weight of 152.24 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one is sourced from PubChem (CID 151973447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).