C10H16O — CID 151973447
(2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one (PubChem CID 151973447) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one.
| Compound Name | (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 151973447 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2E)-2-ethylidene-4,5-dimethylcyclohexan-1-one |
| SMILES | C/C=C1\CC(C)C(C)CC1=O |
| InChI | InChI=1S/C10H16O/c1-4-9-5-7(2)8(3)6-10(9)11/h4,7-8H,5-6H2,1-3H3/b9-4+ |
| InChIKey | UBDVHUCXWZCAIJ-RUDMXATFSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|