C40H36O7 — CID 135243627
2-[[7-[(1E)-1-[2-methyl-5-(oxiran-2-ylmethoxy)phenyl]buta-1,3-dien-2-yl]oxy-1-[7-(oxiran-2-ylmethoxy)naphthalen-2-yl]naphthalen-2-yl]oxymethyl]oxirane (PubChem CID 135243627) has the molecular formula C40H36O7 and a molecular weight of 628.72 g/mol. Its IUPAC name is 2-[[7-[(1E)-1-[2-methyl-5-(oxiran-2-ylmethoxy)phenyl]buta-1,3-dien-2-yl]oxy-1-[7-(oxiran-2-ylmethoxy)naphthalen-2-yl]naphthalen-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[7-[(1E)-1-[2-methyl-5-(oxiran-2-ylmethoxy)phenyl]buta-1,3-dien-2-yl]oxy-1-[7-(oxiran-2-ylmethoxy)naphthalen-2-yl]naphthalen-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 135243627 |
| Molecular Formula | C40H36O7 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | 2-[[7-[(1E)-1-[2-methyl-5-(oxiran-2-ylmethoxy)phenyl]buta-1,3-dien-2-yl]oxy-1-[7-(oxiran-2-ylmethoxy)naphthalen-2-yl]naphthalen-2-yl]oxymethyl]oxirane |
| SMILES | C=C/C(=C\c1cc(OCC2CO2)ccc1C)Oc1ccc2ccc(OCC3CO3)c(-c3ccc4ccc(OCC5CO5)cc4c3)c2c1 |
| InChI | InChI=1S/C40H36O7/c1-3-31(15-29-16-32(10-4-25(29)2)41-19-35-21-43-35)47-34-12-8-27-9-13-39(46-24-37-23-45-37)40(38(27)18-34)28-6-5-26-7-11-33(17-30(26)14-28)42-20-36-22-44-36/h3-18,35-37H,1,19-24H2,2H3/b31-15+ |
| InChIKey | LONMXKBAJDLVMD-IBBHUPRXSA-N |
| XLogP | 7.91 |
| TPSA | 74.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|