C18H18Cl2N2O2S — CID 135244191
6-[(3,4-dichlorophenoxy)methyl]-N-methylsulfanyl-5-propyl-1,2-benzoxazol-3-amine (PubChem CID 135244191) has the molecular formula C18H18Cl2N2O2S and a molecular weight of 397.33 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenoxy)methyl]-N-methylsulfanyl-5-propyl-1,2-benzoxazol-3-amine.
| Compound Name | 6-[(3,4-dichlorophenoxy)methyl]-N-methylsulfanyl-5-propyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 135244191 |
| Molecular Formula | C18H18Cl2N2O2S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 6-[(3,4-dichlorophenoxy)methyl]-N-methylsulfanyl-5-propyl-1,2-benzoxazol-3-amine |
| SMILES | CCCc1cc2c(NSC)noc2cc1COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2S/c1-3-4-11-7-14-17(24-21-18(14)22-25-2)8-12(11)10-23-13-5-6-15(19)16(20)9-13/h5-9H,3-4,10H2,1-2H3,(H,21,22) |
| InChIKey | YVCIFXOLUXPLIT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|