C12H16N2O2 — CID 135245106
N'-(2-formylphenyl)-2-methoxy-N,N-dimethylethanimidamide (PubChem CID 135245106) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N'-(2-formylphenyl)-2-methoxy-N,N-dimethylethanimidamide.
| Compound Name | N'-(2-formylphenyl)-2-methoxy-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 135245106 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N'-(2-formylphenyl)-2-methoxy-N,N-dimethylethanimidamide |
| SMILES | COC/C(=N\c1ccccc1C=O)N(C)C |
| InChI | InChI=1S/C12H16N2O2/c1-14(2)12(9-16-3)13-11-7-5-4-6-10(11)8-15/h4-8H,9H2,1-3H3/b13-12+ |
| InChIKey | UNWZIBQXMPASRN-OUKQBFOZSA-N |
| XLogP | 1.74 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|