C25H21N3 — CID 135245262
2-[4-(4-cyanophenyl)phenyl]-4-methylcyclodeca-1,3,5,7,9-pentaene-1-carboximidamide (PubChem CID 135245262) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)phenyl]-4-methylcyclodeca-1,3,5,7,9-pentaene-1-carboximidamide.
| Compound Name | 2-[4-(4-cyanophenyl)phenyl]-4-methylcyclodeca-1,3,5,7,9-pentaene-1-carboximidamide |
|---|---|
| PubChem CID | 135245262 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[4-(4-cyanophenyl)phenyl]-4-methylcyclodeca-1,3,5,7,9-pentaene-1-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccccccc(C)cc1-c1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C25H21N3/c1-18-6-4-2-3-5-7-23(25(27)28)24(16-18)22-14-12-21(13-15-22)20-10-8-19(17-26)9-11-20/h2-16H,1H3,(H3,27,28)/b3-2-,4-2-,5-3+,6-4-,7-5+,18-6+,18-16+,23-7+,24-16-,24-23- |
| InChIKey | DVOKHIOJAJYMRU-SILHSSEISA-N |
| XLogP | 5.61 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|