C16H22F3NO4 — CID 135251199
[(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] N-butylcarbamate (PubChem CID 135251199) has the molecular formula C16H22F3NO4 and a molecular weight of 349.35 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] N-butylcarbamate.
| Compound Name | [(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 135251199 |
| Molecular Formula | C16H22F3NO4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)O[C@H](COCc1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H22F3NO4/c1-3-4-9-20-15(21)24-14(16(17,18)19)11-23-10-12-5-7-13(22-2)8-6-12/h5-8,14H,3-4,9-11H2,1-2H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | KIILVDOZUIYQBT-CQSZACIVSA-N |
| XLogP | 3.67 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|