C21H29N3O4 — CID 135252928
(2S)-2-[[5-[3-(1,3-benzodioxol-5-yl)propoxy]-2-methylpyrimidin-4-yl]amino]hexan-1-ol (PubChem CID 135252928) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2S)-2-[[5-[3-(1,3-benzodioxol-5-yl)propoxy]-2-methylpyrimidin-4-yl]amino]hexan-1-ol.
| Compound Name | (2S)-2-[[5-[3-(1,3-benzodioxol-5-yl)propoxy]-2-methylpyrimidin-4-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 135252928 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2S)-2-[[5-[3-(1,3-benzodioxol-5-yl)propoxy]-2-methylpyrimidin-4-yl]amino]hexan-1-ol |
| SMILES | CCCC[C@@H](CO)Nc1nc(C)ncc1OCCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H29N3O4/c1-3-4-7-17(13-25)24-21-20(12-22-15(2)23-21)26-10-5-6-16-8-9-18-19(11-16)28-14-27-18/h8-9,11-12,17,25H,3-7,10,13-14H2,1-2H3,(H,22,23,24)/t17-/m0/s1 |
| InChIKey | BICPQIQPTGCZHV-KRWDZBQOSA-N |
| XLogP | 3.49 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|