C22H30O3 — CID 172837162
1-(1,3-benzodioxol-5-yl)pentan-2-ol;butylbenzene (PubChem CID 172837162) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)pentan-2-ol;butylbenzene.
| Compound Name | 1-(1,3-benzodioxol-5-yl)pentan-2-ol;butylbenzene |
|---|---|
| PubChem CID | 172837162 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)pentan-2-ol;butylbenzene |
| SMILES | CCCC(O)Cc1ccc2c(c1)OCO2.CCCCc1ccccc1 |
| InChI | InChI=1S/C12H16O3.C10H14/c1-2-3-10(13)6-9-4-5-11-12(7-9)15-8-14-11;1-2-3-7-10-8-5-4-6-9-10/h4-5,7,10,13H,2-3,6,8H2,1H3;4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | WHNKQRPVACCZGT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |