About methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate
methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate (PubChem CID 135255088) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate.
Analyze methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate?
The IUPAC name of methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate (CID 135255088) is methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate.
What is the SMILES notation for methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate?
The canonical SMILES for methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate is COC(=O)CNC(=O)C1(C)CCCC1(C)C.
What is the InChIKey of methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate?
The InChIKey is ACAAYZFTGCVKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-11(2)6-5-7-12(11,3)10(15)13-8-9(14)16-4/h5-8H2,1-4H3,(H,13,15).
What are the key properties of methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate?
methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate has a molecular weight of 227.30 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,2,2-trimethylcyclopentanecarbonyl)amino]acetate is sourced from PubChem (CID 135255088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).