C26H29N7O3 — CID 135256376
N-[4-[(Z)-1-amino-2-[amino-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]amino]ethenyl]-6-(3-cyanophenyl)-2-pyridinyl]-2-methoxyacetamide (PubChem CID 135256376) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[4-[(Z)-1-amino-2-[amino-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]amino]ethenyl]-6-(3-cyanophenyl)-2-pyridinyl]-2-methoxyacetamide.
| Compound Name | N-[4-[(Z)-1-amino-2-[amino-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]amino]ethenyl]-6-(3-cyanophenyl)-2-pyridinyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 135256376 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-[4-[(Z)-1-amino-2-[amino-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]amino]ethenyl]-6-(3-cyanophenyl)-2-pyridinyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(/C(N)=C/N(N)Cc2cccc(C(C)OC)n2)cc(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C26H29N7O3/c1-17(36-3)23-9-5-8-21(30-23)14-33(29)15-22(28)20-11-24(19-7-4-6-18(10-19)13-27)31-25(12-20)32-26(34)16-35-2/h4-12,15,17H,14,16,28-29H2,1-3H3,(H,31,32,34)/b22-15- |
| InChIKey | QFYPRLMSLYDLHY-JCMHNJIXSA-N |
| XLogP | 2.94 |
| TPSA | 152.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|