C15H25N3S — CID 135258457
2-[5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]-2-pyridinyl]propane-2-thiol (PubChem CID 135258457) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 2-[5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]-2-pyridinyl]propane-2-thiol.
| Compound Name | 2-[5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]-2-pyridinyl]propane-2-thiol |
|---|---|
| PubChem CID | 135258457 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-[5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]-2-pyridinyl]propane-2-thiol |
| SMILES | C[C@@H]1CN(c2ccc(C(C)(C)S)nc2)C[C@H](C)N1C |
| InChI | InChI=1S/C15H25N3S/c1-11-9-18(10-12(2)17(11)5)13-6-7-14(16-8-13)15(3,4)19/h6-8,11-12,19H,9-10H2,1-5H3/t11-,12+ |
| InChIKey | FQOVIYOMFIVAKZ-TXEJJXNPSA-N |
| XLogP | 2.78 |
| TPSA | 19.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|