C10H21N3O3 — CID 135263145
methyl-[3-(2-oxo-1,3-diazinan-1-yl)propyl]azanium acetate (PubChem CID 135263145) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is methyl-[3-(2-oxo-1,3-diazinan-1-yl)propyl]azanium acetate.
| Compound Name | methyl-[3-(2-oxo-1,3-diazinan-1-yl)propyl]azanium acetate |
|---|---|
| PubChem CID | 135263145 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | methyl-[3-(2-oxo-1,3-diazinan-1-yl)propyl]azanium acetate |
| SMILES | CC(=O)[O-].C[NH2+]CCCN1CCCNC1=O |
| InChI | InChI=1S/C8H17N3O.C2H4O2/c1-9-4-2-6-11-7-3-5-10-8(11)12;1-2(3)4/h9H,2-7H2,1H3,(H,10,12);1H3,(H,3,4) |
| InChIKey | TUYYITINAYXYON-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|