C9H15ClN4 — CID 135271004
4-N-butyl-5-chloro-6-methylpyrimidine-2,4-diamine (PubChem CID 135271004) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is 4-N-butyl-5-chloro-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-chloro-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135271004 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 4-N-butyl-5-chloro-6-methylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(C)c1Cl |
| InChI | InChI=1S/C9H15ClN4/c1-3-4-5-12-8-7(10)6(2)13-9(11)14-8/h3-5H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | QGTRPZQPBFUHDP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|