C25H54N2O4 — CID 135274460
N,N,N',N'-tetrakis(3-propan-2-yloxypropyl)methanediamine (PubChem CID 135274460) has the molecular formula C25H54N2O4 and a molecular weight of 446.72 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(3-propan-2-yloxypropyl)methanediamine.
| Compound Name | N,N,N',N'-tetrakis(3-propan-2-yloxypropyl)methanediamine |
|---|---|
| PubChem CID | 135274460 |
| Molecular Formula | C25H54N2O4 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.41 |
| IUPAC Name | N,N,N',N'-tetrakis(3-propan-2-yloxypropyl)methanediamine |
| SMILES | CC(C)OCCCN(CCCOC(C)C)CN(CCCOC(C)C)CCCOC(C)C |
| InChI | InChI=1S/C25H54N2O4/c1-22(2)28-17-9-13-26(14-10-18-29-23(3)4)21-27(15-11-19-30-24(5)6)16-12-20-31-25(7)8/h22-25H,9-21H2,1-8H3 |
| InChIKey | PCGCPIFUCVQADZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|