C13H28S — CID 135274514
2,6-dimethyl-4-(2-methylpropylsulfanyl)heptane (PubChem CID 135274514) has the molecular formula C13H28S and a molecular weight of 216.43 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-methylpropylsulfanyl)heptane.
| Compound Name | 2,6-dimethyl-4-(2-methylpropylsulfanyl)heptane |
|---|---|
| PubChem CID | 135274514 |
| Molecular Formula | C13H28S |
| Molecular Weight | 216.43 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2,6-dimethyl-4-(2-methylpropylsulfanyl)heptane |
| SMILES | CC(C)CSC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H28S/c1-10(2)7-13(8-11(3)4)14-9-12(5)6/h10-13H,7-9H2,1-6H3 |
| InChIKey | IINWZFFKCRDKGW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |