C11H16N2 — CID 135275915
N-(2,5-dimethylphenyl)-N'-ethylmethanimidamide (PubChem CID 135275915) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N'-ethylmethanimidamide.
| Compound Name | N-(2,5-dimethylphenyl)-N'-ethylmethanimidamide |
|---|---|
| PubChem CID | 135275915 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N'-ethylmethanimidamide |
| SMILES | CC/N=C/Nc1cc(C)ccc1C |
| InChI | InChI=1S/C11H16N2/c1-4-12-8-13-11-7-9(2)5-6-10(11)3/h5-8H,4H2,1-3H3,(H,12,13) |
| InChIKey | NNSZTIINUURWAA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|