C17H11ClN4OS — CID 135276771
5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one (PubChem CID 135276771) has the molecular formula C17H11ClN4OS and a molecular weight of 354.82 g/mol. Its IUPAC name is 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one.
| Compound Name | 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one |
|---|---|
| PubChem CID | 135276771 |
| Molecular Formula | C17H11ClN4OS |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Nc2ccccc2)cnn1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H11ClN4OS/c18-15-13(20-11-6-2-1-3-7-11)10-19-22(16(15)23)17-21-12-8-4-5-9-14(12)24-17/h1-10,20H |
| InChIKey | ONPFSUAWWIXTQI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |