About 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one
5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one (PubChem CID 135276771) has the molecular formula C17H11ClN4OS
and a molecular weight of 354.82 g/mol. Its IUPAC name is 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one.
Molecular Properties
| Compound Name | 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one |
| PubChem CID | 135276771 |
| Molecular Formula | C17H11ClN4OS |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Nc2ccccc2)cnn1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H11ClN4OS/c18-15-13(20-11-6-2-1-3-7-11)10-19-22(16(15)23)17-21-12-8-4-5-9-14(12)24-17/h1-10,20H |
| InChIKey | ONPFSUAWWIXTQI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one?
The IUPAC name of 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one (CID 135276771) is 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one.
What is the SMILES notation for 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one?
The canonical SMILES for 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one is O=c1c(Cl)c(Nc2ccccc2)cnn1-c1nc2ccccc2s1.
What is the InChIKey of 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one?
The InChIKey is ONPFSUAWWIXTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN4OS/c18-15-13(20-11-6-2-1-3-7-11)10-19-22(16(15)23)17-21-12-8-4-5-9-14(12)24-17/h1-10,20H.
What are the key properties of 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one?
5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one has a molecular weight of 354.82 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-anilino-2-(1,3-benzothiazol-2-yl)-4-chloropyridazin-3-one is sourced from PubChem (CID 135276771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).