C22H25N2O2S+ — CID 135278740
4-[2-(cyclopropylmethoxy)-5-cyclopropylsulfanylphenyl]-7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium (PubChem CID 135278740) has the molecular formula C22H25N2O2S+ and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[2-(cyclopropylmethoxy)-5-cyclopropylsulfanylphenyl]-7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium.
| Compound Name | 4-[2-(cyclopropylmethoxy)-5-cyclopropylsulfanylphenyl]-7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium |
|---|---|
| PubChem CID | 135278740 |
| Molecular Formula | C22H25N2O2S+ |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[2-(cyclopropylmethoxy)-5-cyclopropylsulfanylphenyl]-7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium |
| SMILES | CO[n+]1c(C)cc(-c2cc(SC3CC3)ccc2OCC2CC2)c2cc[nH]c21 |
| InChI | InChI=1S/C22H24N2O2S/c1-14-11-19(18-9-10-23-22(18)24(14)25-2)20-12-17(27-16-5-6-16)7-8-21(20)26-13-15-3-4-15/h7-12,15-16H,3-6,13H2,1-2H3/p+1 |
| InChIKey | YNEMTAKZVCZUBW-UHFFFAOYSA-O |
| XLogP | 4.53 |
| TPSA | 38.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|