C23H45N5O2 — CID 135279819
methyl N'-cyclohexyl-N-[3-[[3-[[ethylamino(methoxy)methylidene]amino]propyl-methylamino]methyl]cyclohexyl]carbamimidate (PubChem CID 135279819) has the molecular formula C23H45N5O2 and a molecular weight of 423.65 g/mol. Its IUPAC name is methyl N'-cyclohexyl-N-[3-[[3-[[ethylamino(methoxy)methylidene]amino]propyl-methylamino]methyl]cyclohexyl]carbamimidate.
| Compound Name | methyl N'-cyclohexyl-N-[3-[[3-[[ethylamino(methoxy)methylidene]amino]propyl-methylamino]methyl]cyclohexyl]carbamimidate |
|---|---|
| PubChem CID | 135279819 |
| Molecular Formula | C23H45N5O2 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.36 |
| IUPAC Name | methyl N'-cyclohexyl-N-[3-[[3-[[ethylamino(methoxy)methylidene]amino]propyl-methylamino]methyl]cyclohexyl]carbamimidate |
| SMILES | CCN/C(=N/CCCN(C)CC1CCCC(N/C(=N/C2CCCCC2)OC)C1)OC |
| InChI | InChI=1S/C23H45N5O2/c1-5-24-22(29-3)25-15-10-16-28(2)18-19-11-9-14-21(17-19)27-23(30-4)26-20-12-7-6-8-13-20/h19-21H,5-18H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | VOTNCRCBIXUKHN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|