C18H18F3N — CID 135280715
N-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]butan-1-imine (PubChem CID 135280715) has the molecular formula C18H18F3N and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]butan-1-imine.
| Compound Name | N-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]butan-1-imine |
|---|---|
| PubChem CID | 135280715 |
| Molecular Formula | C18H18F3N |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]butan-1-imine |
| SMILES | CCC/C(=N\c1ccccc1C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3N/c1-3-7-17(22-16-11-5-4-8-13(16)2)14-9-6-10-15(12-14)18(19,20)21/h4-6,8-12H,3,7H2,1-2H3/b22-17+ |
| InChIKey | NWISMHNXXSOBKR-OQKWZONESA-N |
| XLogP | 5.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|