C17H24N2 — CID 135280988
4-[2-methyl-1-[[(3E)-penta-1,3-dien-3-yl]amino]butyl]cyclohexa-1,5-diene-1-carbonitrile (PubChem CID 135280988) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-[2-methyl-1-[[(3E)-penta-1,3-dien-3-yl]amino]butyl]cyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 4-[2-methyl-1-[[(3E)-penta-1,3-dien-3-yl]amino]butyl]cyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 135280988 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-[2-methyl-1-[[(3E)-penta-1,3-dien-3-yl]amino]butyl]cyclohexa-1,5-diene-1-carbonitrile |
| SMILES | C=C/C(=C\C)NC(C(C)CC)C1C=CC(C#N)=CC1 |
| InChI | InChI=1S/C17H24N2/c1-5-13(4)17(19-16(6-2)7-3)15-10-8-14(12-18)9-11-15/h6-10,13,15,17,19H,2,5,11H2,1,3-4H3/b16-7+ |
| InChIKey | KNJPBUPBOIXGBV-FRKPEAEDSA-N |
| XLogP | 4.11 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|