C15H12ClIN2O2 — CID 135281243
2-(5-chloro-2,4-dimethoxyphenyl)-6-iodoimidazo[1,2-a]pyridine (PubChem CID 135281243) has the molecular formula C15H12ClIN2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyphenyl)-6-iodoimidazo[1,2-a]pyridine.
| Compound Name | 2-(5-chloro-2,4-dimethoxyphenyl)-6-iodoimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 135281243 |
| Molecular Formula | C15H12ClIN2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyphenyl)-6-iodoimidazo[1,2-a]pyridine |
| SMILES | COc1cc(OC)c(-c2cn3cc(I)ccc3n2)cc1Cl |
| InChI | InChI=1S/C15H12ClIN2O2/c1-20-13-6-14(21-2)11(16)5-10(13)12-8-19-7-9(17)3-4-15(19)18-12/h3-8H,1-2H3 |
| InChIKey | HWZAVWFCGHKARM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|