C19H21ClN4O5 — CID 135335103
2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]amino]ethylcarbamic acid (PubChem CID 135335103) has the molecular formula C19H21ClN4O5 and a molecular weight of 420.85 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]amino]ethylcarbamic acid.
| Compound Name | 2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 135335103 |
| Molecular Formula | C19H21ClN4O5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]amino]ethylcarbamic acid |
| SMILES | COc1cc(OC)c(-c2cn3cc(NCCNC(=O)O)c(OC)cc3n2)cc1Cl |
| InChI | InChI=1S/C19H21ClN4O5/c1-27-15-7-16(28-2)12(20)6-11(15)13-9-24-10-14(21-4-5-22-19(25)26)17(29-3)8-18(24)23-13/h6-10,21-22H,4-5H2,1-3H3,(H,25,26) |
| InChIKey | MGLZYYUAPUYRJG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|