C24H22N4O — CID 135285910
4-(6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene (PubChem CID 135285910) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-(6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene.
| Compound Name | 4-(6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 135285910 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-(6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene |
| SMILES | COc1ccc(-c2ccc3nc4n(c3c2)C(c2ccccc2)C2CNCC42)cn1 |
| InChI | InChI=1S/C24H22N4O/c1-29-22-10-8-17(12-26-22)16-7-9-20-21(11-16)28-23(15-5-3-2-4-6-15)18-13-25-14-19(18)24(28)27-20/h2-12,18-19,23,25H,13-14H2,1H3 |
| InChIKey | DDDWRDSBPPTAAS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |